Mixture of Edoxaban (RSS)-Isomer and Edoxaban (SRR)- Isomer
| CAT. No. | CP-E8180 |
|---|---|
| CAS. No. | 1255529-25-9 + 1255529-26-0 |
| Mol. F. | C24H30ClN7O4S + C24H30ClN7O4S |
| Mol. Wt. | 548.06 + 548.06 |
| Stock Status | Custom Synthesis |
- Category: Impurity Standards
- Synonyms: NA
- Chemical Name: N-(5-Chloropyridin-2-yl)-N’-[(1R,2S,4S)-4-[(dimethylamino)carbonyl]-2-[[(5-methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)carbonyl]amino]cyclohexyl]ethanediamide and N1-(5-Chloropyridin-2-yl)-N2-((1S,2R,4R)-4-(dimethylcarbamoyl)-2-(5-methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine-2-carboxamido)cyclohexyl)oxalamide
Request for Quotation : Mixture of Edoxaban (RSS)-Isomer and Edoxaban (SRR)- Isomer
Related Products
| CAT. No. | CP-E8008 |
|---|---|
| CAS. No. | 767625-11-6 |
| Mol. F. | C19H27N5O5S |
| Mol. Wt. | 437.52 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8005 |
|---|---|
| CAS. No. | 480452-36-6 |
| Mol. F. | C21H30ClN5O5 |
| Mol. Wt. | 467.95 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8003 |
|---|---|
| CAS. No. | 775280-48-3 |
| Mol. F. | C24H30BrN7O4S |
| Mol. Wt. | 592.51 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8002 |
|---|---|
| CAS. No. | 482375-18-8 |
| Mol. F. | C16H22ClN5O3 : HCl |
| Mol. Wt. | 367.8 : 36.46 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8006 |
|---|---|
| CAS. No. | 2568974-02-5 |
| Mol. F. | C23H25Cl2N7O5 |
| Mol. Wt. | 550.4 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8009 |
|---|---|
| CAS. No. | 1255529-23-7 |
| Mol. F. | C24H30ClN7O4S |
| Mol. Wt. | 548.06 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8004 |
|---|---|
| CAS. No. | 1243308-37-3 |
| Mol. F. | C9H9ClN2O3 : HCl |
| Mol. Wt. | 228.6 : 36.46 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8023 |
|---|---|
| CAS. No. | NA |
| Mol. F. | C6H8N4OS |
| Mol. Wt. | 184.22 |
| Stock Status: | Custom Synthesis |
| CAT. No. | CP-E8010 |
|---|---|
| CAS. No. | 500572-10-1 |
| Mol. F. | C24H30ClN7O4S |
| Mol. Wt. | 548.1 |
| Stock Status: | Custom Synthesis |
| CAT. No. | CP-E8011 |
|---|---|
| CAS. No. | 349125-14-0 |
| Mol. F. | C12H8Cl2N4O2 |
| Mol. Wt. | 311.12 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8012 |
|---|---|
| CAS. No. | NA |
| Mol. F. | C23H27Cl2N7O4 |
| Mol. Wt. | 536.41 |
| Stock Status: | In Stock |
| CAT. No. | CP-E8013 |
|---|---|
| CAS. No. | 143150-92-9 |
| Mol. F. | C7H9BrN2S |
| Mol. Wt. | 233.13 |
| Stock Status: | In Stock |
